C14H25NO4S2 — CID 175111448
tert-butyl 4-[3,3-bis(hydroxysulfanyl)cyclobutyl]piperidine-1-carboxylate (PubChem CID 175111448) has the molecular formula C14H25NO4S2 and a molecular weight of 335.49 g/mol. Its IUPAC name is tert-butyl 4-[3,3-bis(hydroxysulfanyl)cyclobutyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3,3-bis(hydroxysulfanyl)cyclobutyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175111448 |
| Molecular Formula | C14H25NO4S2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | tert-butyl 4-[3,3-bis(hydroxysulfanyl)cyclobutyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2CC(SO)(SO)C2)CC1 |
| InChI | InChI=1S/C14H25NO4S2/c1-13(2,3)19-12(16)15-6-4-10(5-7-15)11-8-14(9-11,20-17)21-18/h10-11,17-18H,4-9H2,1-3H3 |
| InChIKey | UFSAOKIWSZIXBW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|