C17H15NO2 — CID 175112380
bicyclo[2.2.0]hexa-1,3,5-triene;1-ethynyl-2-nitro-3-propylbenzene (PubChem CID 175112380) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;1-ethynyl-2-nitro-3-propylbenzene.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;1-ethynyl-2-nitro-3-propylbenzene |
|---|---|
| PubChem CID | 175112380 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;1-ethynyl-2-nitro-3-propylbenzene |
| SMILES | C#Cc1cccc(CCC)c1[N+](=O)[O-].c1cc2ccc1-2 |
| InChI | InChI=1S/C11H11NO2.C6H4/c1-3-6-10-8-5-7-9(4-2)11(10)12(13)14;1-2-6-4-3-5(1)6/h2,5,7-8H,3,6H2,1H3;1-4H |
| InChIKey | IDGFJBCABQBEOG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|