C28H30O3 — CID 175112409
1-(4-cyclohexyloxyphenyl)-6-(4-prop-2-enylphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 175112409) has the molecular formula C28H30O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-(4-cyclohexyloxyphenyl)-6-(4-prop-2-enylphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | 1-(4-cyclohexyloxyphenyl)-6-(4-prop-2-enylphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 175112409 |
| Molecular Formula | C28H30O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 1-(4-cyclohexyloxyphenyl)-6-(4-prop-2-enylphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | C=CCc1ccc(C(=C)C(=O)CC(=O)C=Cc2ccc(OC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C28H30O3/c1-3-7-22-10-15-24(16-11-22)21(2)28(30)20-25(29)17-12-23-13-18-27(19-14-23)31-26-8-5-4-6-9-26/h3,10-19,26H,1-2,4-9,20H2 |
| InChIKey | RKOFNUIWOYOBQM-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|