About 1,5-diphenyltetrazole;2-methyl-1,3-thiazole
1,5-diphenyltetrazole;2-methyl-1,3-thiazole (PubChem CID 175112675) has the molecular formula C17H15N5S
and a molecular weight of 321.41 g/mol. Its IUPAC name is 1,5-diphenyltetrazole;2-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 1,5-diphenyltetrazole;2-methyl-1,3-thiazole |
| PubChem CID | 175112675 |
| Molecular Formula | C17H15N5S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 1,5-diphenyltetrazole;2-methyl-1,3-thiazole |
| SMILES | Cc1nccs1.c1ccc(-c2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H10N4.C4H5NS/c1-3-7-11(8-4-1)13-14-15-16-17(13)12-9-5-2-6-10-12;1-4-5-2-3-6-4/h1-10H;2-3H,1H3 |
| InChIKey | GGFXSDNEOMHHFJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,5-diphenyltetrazole;2-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diphenyltetrazole;2-methyl-1,3-thiazole?
The IUPAC name of 1,5-diphenyltetrazole;2-methyl-1,3-thiazole (CID 175112675) is 1,5-diphenyltetrazole;2-methyl-1,3-thiazole.
What is the SMILES notation for 1,5-diphenyltetrazole;2-methyl-1,3-thiazole?
The canonical SMILES for 1,5-diphenyltetrazole;2-methyl-1,3-thiazole is Cc1nccs1.c1ccc(-c2nnnn2-c2ccccc2)cc1.
What is the InChIKey of 1,5-diphenyltetrazole;2-methyl-1,3-thiazole?
The InChIKey is GGFXSDNEOMHHFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4.C4H5NS/c1-3-7-11(8-4-1)13-14-15-16-17(13)12-9-5-2-6-10-12;1-4-5-2-3-6-4/h1-10H;2-3H,1H3.
What are the key properties of 1,5-diphenyltetrazole;2-methyl-1,3-thiazole?
1,5-diphenyltetrazole;2-methyl-1,3-thiazole has a molecular weight of 321.41 g/mol, XLogP of 3.78, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diphenyltetrazole;2-methyl-1,3-thiazole is sourced from PubChem (CID 175112675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).