C17H15N5S — CID 175112675
1,5-diphenyltetrazole;2-methyl-1,3-thiazole (PubChem CID 175112675) has the molecular formula C17H15N5S and a molecular weight of 321.41 g/mol. Its IUPAC name is 1,5-diphenyltetrazole;2-methyl-1,3-thiazole.
| Compound Name | 1,5-diphenyltetrazole;2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 175112675 |
| Molecular Formula | C17H15N5S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 1,5-diphenyltetrazole;2-methyl-1,3-thiazole |
| SMILES | Cc1nccs1.c1ccc(-c2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H10N4.C4H5NS/c1-3-7-11(8-4-1)13-14-15-16-17(13)12-9-5-2-6-10-12;1-4-5-2-3-6-4/h1-10H;2-3H,1H3 |
| InChIKey | GGFXSDNEOMHHFJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |