ethoxy-dimethyl-propylsilane;isocyanic acid

C8H19NO2Si — CID 175112717

IUPACethoxy-dimethyl-propylsilane;isocyanic acid
SMILESCCC[Si](C)(C)OCC.N=C=O
InChIInChI=1S/C7H18OSi.CHNO/c1-5-7-9(3,4)8-6-2;2-1-3/h5-7H2,1-4H3;2H
InChIKeyCSAXHUREAXPSOR-UHFFFAOYSA-N
MW189.33 g/mol
LogP2.54
Rot. Bonds4

About ethoxy-dimethyl-propylsilane;isocyanic acid

ethoxy-dimethyl-propylsilane;isocyanic acid (PubChem CID 175112717) has the molecular formula C8H19NO2Si and a molecular weight of 189.33 g/mol. Its IUPAC name is ethoxy-dimethyl-propylsilane;isocyanic acid.

Molecular Properties

Compound Nameethoxy-dimethyl-propylsilane;isocyanic acid
PubChem CID175112717
Molecular FormulaC8H19NO2Si
Molecular Weight189.33 g/mol
Exact Mass189.12
IUPAC Nameethoxy-dimethyl-propylsilane;isocyanic acid
SMILESCCC[Si](C)(C)OCC.N=C=O
InChIInChI=1S/C7H18OSi.CHNO/c1-5-7-9(3,4)8-6-2;2-1-3/h5-7H2,1-4H3;2H
InChIKeyCSAXHUREAXPSOR-UHFFFAOYSA-N
XLogP2.54
TPSA50.15 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.33
LogP ≤ 52.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}

Analyze ethoxy-dimethyl-propylsilane;isocyanic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethoxy-dimethyl-propylsilane;isocyanic acid?
The IUPAC name of ethoxy-dimethyl-propylsilane;isocyanic acid (CID 175112717) is ethoxy-dimethyl-propylsilane;isocyanic acid.
What is the SMILES notation for ethoxy-dimethyl-propylsilane;isocyanic acid?
The canonical SMILES for ethoxy-dimethyl-propylsilane;isocyanic acid is CCC[Si](C)(C)OCC.N=C=O.
What is the InChIKey of ethoxy-dimethyl-propylsilane;isocyanic acid?
The InChIKey is CSAXHUREAXPSOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18OSi.CHNO/c1-5-7-9(3,4)8-6-2;2-1-3/h5-7H2,1-4H3;2H.
What are the key properties of ethoxy-dimethyl-propylsilane;isocyanic acid?
ethoxy-dimethyl-propylsilane;isocyanic acid has a molecular weight of 189.33 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy-dimethyl-propylsilane;isocyanic acid is sourced from PubChem (CID 175112717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).