C27H32N6O5 — CID 175112802
tert-butyl 3-[[4-[2-(2,6-dimethyl-4-nitrophenoxy)-3-pyridinyl]pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 175112802) has the molecular formula C27H32N6O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is tert-butyl 3-[[4-[2-(2,6-dimethyl-4-nitrophenoxy)-3-pyridinyl]pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-[2-(2,6-dimethyl-4-nitrophenoxy)-3-pyridinyl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175112802 |
| Molecular Formula | C27H32N6O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | tert-butyl 3-[[4-[2-(2,6-dimethyl-4-nitrophenoxy)-3-pyridinyl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1Oc1ncccc1-c1ccnc(NC2CCCN(C(=O)OC(C)(C)C)C2)n1 |
| InChI | InChI=1S/C27H32N6O5/c1-17-14-20(33(35)36)15-18(2)23(17)37-24-21(9-6-11-28-24)22-10-12-29-25(31-22)30-19-8-7-13-32(16-19)26(34)38-27(3,4)5/h6,9-12,14-15,19H,7-8,13,16H2,1-5H3,(H,29,30,31) |
| InChIKey | UXARQKFJOVPGNF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|