C7H7NO8 — CID 175112819
2-[[(2S)-1-oxalooxy-1-oxopropan-2-yl]amino]-2-oxoacetic acid (PubChem CID 175112819) has the molecular formula C7H7NO8 and a molecular weight of 233.13 g/mol. Its IUPAC name is 2-[[(2S)-1-oxalooxy-1-oxopropan-2-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[(2S)-1-oxalooxy-1-oxopropan-2-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 175112819 |
| Molecular Formula | C7H7NO8 |
| Molecular Weight | 233.13 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | 2-[[(2S)-1-oxalooxy-1-oxopropan-2-yl]amino]-2-oxoacetic acid |
| SMILES | C[C@H](NC(=O)C(=O)O)C(=O)OC(=O)C(=O)O |
| InChI | InChI=1S/C7H7NO8/c1-2(8-3(9)4(10)11)6(14)16-7(15)5(12)13/h2H,1H3,(H,8,9)(H,10,11)(H,12,13)/t2-/m0/s1 |
| InChIKey | ZLEQXWOSBDLJBS-REOHCLBHSA-N |
| XLogP | -2.27 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.13 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|