C21H28O4 — CID 175114321
(8R,9S,10R,13R,14S,17R)-17-(2,2-dihydroxyethyl)-10,13-dimethyl-2,8,9,11,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,12-dione (PubChem CID 175114321) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (8R,9S,10R,13R,14S,17R)-17-(2,2-dihydroxyethyl)-10,13-dimethyl-2,8,9,11,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,12-dione.
| Compound Name | (8R,9S,10R,13R,14S,17R)-17-(2,2-dihydroxyethyl)-10,13-dimethyl-2,8,9,11,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,12-dione |
|---|---|
| PubChem CID | 175114321 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (8R,9S,10R,13R,14S,17R)-17-(2,2-dihydroxyethyl)-10,13-dimethyl-2,8,9,11,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,12-dione |
| SMILES | C[C@]12C(=O)C[C@H]3[C@@H](C=CC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2CC(O)O |
| InChI | InChI=1S/C21H28O4/c1-20-8-7-14(22)9-12(20)3-5-15-16-6-4-13(10-19(24)25)21(16,2)18(23)11-17(15)20/h3,5,9,13,15-17,19,24-25H,4,6-8,10-11H2,1-2H3/t13-,15+,16+,17+,20+,21-/m1/s1 |
| InChIKey | DDVRKLLPUIJOAR-KOAXJJDHSA-N |
| XLogP | 2.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|