About 3-phenyliminopropyl 3-propan-2-ylbenzoate
3-phenyliminopropyl 3-propan-2-ylbenzoate (PubChem CID 175116253) has the molecular formula C19H21NO2
and a molecular weight of 295.38 g/mol. Its IUPAC name is 3-phenyliminopropyl 3-propan-2-ylbenzoate.
Molecular Properties
| Compound Name | 3-phenyliminopropyl 3-propan-2-ylbenzoate |
| PubChem CID | 175116253 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 3-phenyliminopropyl 3-propan-2-ylbenzoate |
| SMILES | CC(C)c1cccc(C(=O)OCC/C=N/c2ccccc2)c1 |
| InChI | InChI=1S/C19H21NO2/c1-15(2)16-8-6-9-17(14-16)19(21)22-13-7-12-20-18-10-4-3-5-11-18/h3-6,8-12,14-15H,7,13H2,1-2H3/b20-12+ |
| InChIKey | HKVKXIZOUWDXFE-UDWIEESQSA-N |
| XLogP | 4.76 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyliminopropyl 3-propan-2-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyliminopropyl 3-propan-2-ylbenzoate?
The IUPAC name of 3-phenyliminopropyl 3-propan-2-ylbenzoate (CID 175116253) is 3-phenyliminopropyl 3-propan-2-ylbenzoate.
What is the SMILES notation for 3-phenyliminopropyl 3-propan-2-ylbenzoate?
The canonical SMILES for 3-phenyliminopropyl 3-propan-2-ylbenzoate is CC(C)c1cccc(C(=O)OCC/C=N/c2ccccc2)c1.
What is the InChIKey of 3-phenyliminopropyl 3-propan-2-ylbenzoate?
The InChIKey is HKVKXIZOUWDXFE-UDWIEESQSA-N. The full InChI is InChI=1S/C19H21NO2/c1-15(2)16-8-6-9-17(14-16)19(21)22-13-7-12-20-18-10-4-3-5-11-18/h3-6,8-12,14-15H,7,13H2,1-2H3/b20-12+.
What are the key properties of 3-phenyliminopropyl 3-propan-2-ylbenzoate?
3-phenyliminopropyl 3-propan-2-ylbenzoate has a molecular weight of 295.38 g/mol, XLogP of 4.76, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyliminopropyl 3-propan-2-ylbenzoate is sourced from PubChem (CID 175116253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).