About 3-propyliminopropyl benzoate
3-propyliminopropyl benzoate (PubChem CID 175448950) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-propyliminopropyl benzoate.
Molecular Properties
| Compound Name | 3-propyliminopropyl benzoate |
| PubChem CID | 175448950 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-propyliminopropyl benzoate |
| SMILES | CCC/N=C/CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO2/c1-2-9-14-10-6-11-16-13(15)12-7-4-3-5-8-12/h3-5,7-8,10H,2,6,9,11H2,1H3/b14-10+ |
| InChIKey | DBDONCGHUSTNML-GXDHUFHOSA-N |
| XLogP | 2.71 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-propyliminopropyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyliminopropyl benzoate?
The IUPAC name of 3-propyliminopropyl benzoate (CID 175448950) is 3-propyliminopropyl benzoate.
What is the SMILES notation for 3-propyliminopropyl benzoate?
The canonical SMILES for 3-propyliminopropyl benzoate is CCC/N=C/CCOC(=O)c1ccccc1.
What is the InChIKey of 3-propyliminopropyl benzoate?
The InChIKey is DBDONCGHUSTNML-GXDHUFHOSA-N. The full InChI is InChI=1S/C13H17NO2/c1-2-9-14-10-6-11-16-13(15)12-7-4-3-5-8-12/h3-5,7-8,10H,2,6,9,11H2,1H3/b14-10+.
What are the key properties of 3-propyliminopropyl benzoate?
3-propyliminopropyl benzoate has a molecular weight of 219.28 g/mol, XLogP of 2.71, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyliminopropyl benzoate is sourced from PubChem (CID 175448950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).