C11H13N5O3 — CID 175117107
[(1S)-2-(4-methoxyphenyl)-1-(2H-tetrazol-5-yl)ethyl] carbamate (PubChem CID 175117107) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is [(1S)-2-(4-methoxyphenyl)-1-(2H-tetrazol-5-yl)ethyl] carbamate.
| Compound Name | [(1S)-2-(4-methoxyphenyl)-1-(2H-tetrazol-5-yl)ethyl] carbamate |
|---|---|
| PubChem CID | 175117107 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | [(1S)-2-(4-methoxyphenyl)-1-(2H-tetrazol-5-yl)ethyl] carbamate |
| SMILES | COc1ccc(C[C@H](OC(N)=O)c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C11H13N5O3/c1-18-8-4-2-7(3-5-8)6-9(19-11(12)17)10-13-15-16-14-10/h2-5,9H,6H2,1H3,(H2,12,17)(H,13,14,15,16)/t9-/m0/s1 |
| InChIKey | RPEXMEKOJCEEKG-VIFPVBQESA-N |
| XLogP | 0.59 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |