C17H17Cl2NO — CID 175118287
5-butyl-1,7-dichloro-6H-phenanthridin-6-ol (PubChem CID 175118287) has the molecular formula C17H17Cl2NO and a molecular weight of 322.23 g/mol. Its IUPAC name is 5-butyl-1,7-dichloro-6H-phenanthridin-6-ol.
| Compound Name | 5-butyl-1,7-dichloro-6H-phenanthridin-6-ol |
|---|---|
| PubChem CID | 175118287 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 5-butyl-1,7-dichloro-6H-phenanthridin-6-ol |
| SMILES | CCCCN1c2cccc(Cl)c2-c2cccc(Cl)c2C1O |
| InChI | InChI=1S/C17H17Cl2NO/c1-2-3-10-20-14-9-5-8-12(18)15(14)11-6-4-7-13(19)16(11)17(20)21/h4-9,17,21H,2-3,10H2,1H3 |
| InChIKey | ATEKNNAHIGJILF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |