C15H13N2O4S- — CID 175122811
4-[2-(4-carbamoylanilino)-2-oxoethyl]benzenesulfinate (PubChem CID 175122811) has the molecular formula C15H13N2O4S- and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-[2-(4-carbamoylanilino)-2-oxoethyl]benzenesulfinate.
| Compound Name | 4-[2-(4-carbamoylanilino)-2-oxoethyl]benzenesulfinate |
|---|---|
| PubChem CID | 175122811 |
| Molecular Formula | C15H13N2O4S- |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-[2-(4-carbamoylanilino)-2-oxoethyl]benzenesulfinate |
| SMILES | NC(=O)c1ccc(NC(=O)Cc2ccc(S(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C15H14N2O4S/c16-15(19)11-3-5-12(6-4-11)17-14(18)9-10-1-7-13(8-2-10)22(20)21/h1-8H,9H2,(H2,16,19)(H,17,18)(H,20,21)/p-1 |
| InChIKey | YVSIAKKOAAQTOW-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|