C16H13NO6 — CID 175125033
2-(4-ethoxyphenyl)-6-nitro-1,3-benzodioxole-5-carbaldehyde (PubChem CID 175125033) has the molecular formula C16H13NO6 and a molecular weight of 315.28 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-6-nitro-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 2-(4-ethoxyphenyl)-6-nitro-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 175125033 |
| Molecular Formula | C16H13NO6 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-(4-ethoxyphenyl)-6-nitro-1,3-benzodioxole-5-carbaldehyde |
| SMILES | CCOc1ccc(C2Oc3cc(C=O)c([N+](=O)[O-])cc3O2)cc1 |
| InChI | InChI=1S/C16H13NO6/c1-2-21-12-5-3-10(4-6-12)16-22-14-7-11(9-18)13(17(19)20)8-15(14)23-16/h3-9,16H,2H2,1H3 |
| InChIKey | RGZQAQFEVPUIPC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|