C14H16O5 — CID 70512552
2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 70512552) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 70512552 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCOc1ccc(C2OC(=O)C(C)(C)C(=O)O2)cc1 |
| InChI | InChI=1S/C14H16O5/c1-4-17-10-7-5-9(6-8-10)11-18-12(15)14(2,3)13(16)19-11/h5-8,11H,4H2,1-3H3 |
| InChIKey | GCUFTTBXVLQQDE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|