C12H12ClNO3 — CID 106694973
3-chloro-4-(4-ethoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 106694973) has the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. Its IUPAC name is 3-chloro-4-(4-ethoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-chloro-4-(4-ethoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106694973 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3-chloro-4-(4-ethoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(C2C(=O)NC(=O)C2Cl)cc1 |
| InChI | InChI=1S/C12H12ClNO3/c1-2-17-8-5-3-7(4-6-8)9-10(13)12(16)14-11(9)15/h3-6,9-10H,2H2,1H3,(H,14,15,16) |
| InChIKey | WHNNQTIBHOBMSI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|