About CID 175126111
CID 175126111 (PubChem CID 175126111) has the molecular formula C18H17F2Si
and a molecular weight of 299.42 g/mol.
Molecular Properties
| Compound Name | CID 175126111 |
| PubChem CID | 175126111 |
| Molecular Formula | C18H17F2Si |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | — |
| SMILES | F.F.c1ccc([Si](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15Si.2FH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;2*1H |
| InChIKey | VLRFJRZDPQGWOU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 175126111 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175126111?
The IUPAC name of CID 175126111 (CID 175126111) is not available.
What is the SMILES notation for CID 175126111?
The canonical SMILES for CID 175126111 is F.F.c1ccc([Si](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 175126111?
The InChIKey is VLRFJRZDPQGWOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Si.2FH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;2*1H.
What are the key properties of CID 175126111?
CID 175126111 has a molecular weight of 299.42 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175126111 is sourced from PubChem (CID 175126111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).