About Triphenylsilicon
Triphenylsilicon (PubChem CID 6327682) has the molecular formula C18H15Si
and a molecular weight of 259.40 g/mol.
Molecular Properties
| Compound Name | Triphenylsilicon |
| PubChem CID | 6327682 |
| Molecular Formula | C18H15Si |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | — |
| SMILES | c1ccc([Si](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15Si/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | BZLZKLMROPIZSR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze Triphenylsilicon with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triphenylsilicon?
The IUPAC name of Triphenylsilicon (CID 6327682) is not available.
What is the SMILES notation for Triphenylsilicon?
The canonical SMILES for Triphenylsilicon is c1ccc([Si](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of Triphenylsilicon?
The InChIKey is BZLZKLMROPIZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Si/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H.
What are the key properties of Triphenylsilicon?
Triphenylsilicon has a molecular weight of 259.40 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Triphenylsilicon is sourced from PubChem (CID 6327682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).