C8H13N7O5 — CID 175126711
[(3R,4R,5S,6R)-3-amino-6-(azidomethyl)-4,5-dihydroxyoxan-2-yl] 2-azidoacetate (PubChem CID 175126711) has the molecular formula C8H13N7O5 and a molecular weight of 287.24 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-3-amino-6-(azidomethyl)-4,5-dihydroxyoxan-2-yl] 2-azidoacetate.
| Compound Name | [(3R,4R,5S,6R)-3-amino-6-(azidomethyl)-4,5-dihydroxyoxan-2-yl] 2-azidoacetate |
|---|---|
| PubChem CID | 175126711 |
| Molecular Formula | C8H13N7O5 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [(3R,4R,5S,6R)-3-amino-6-(azidomethyl)-4,5-dihydroxyoxan-2-yl] 2-azidoacetate |
| SMILES | [N-]=[N+]=NCC(=O)OC1O[C@H](CN=[N+]=[N-])[C@@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C8H13N7O5/c9-5-7(18)6(17)3(1-12-14-10)19-8(5)20-4(16)2-13-15-11/h3,5-8,17-18H,1-2,9H2/t3-,5-,6-,7-,8?/m1/s1 |
| InChIKey | CMSUSNUBVOPYOT-ZQLGFOCFSA-N |
| XLogP | -1.08 |
| TPSA | 199.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|