C13H21N3O9 — CID 10522707
dimethyl 3-[(2R,3R,4S,5S,6R)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl]oxypentanedioate (PubChem CID 10522707) has the molecular formula C13H21N3O9 and a molecular weight of 363.32 g/mol. Its IUPAC name is dimethyl 3-[(2R,3R,4S,5S,6R)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl]oxypentanedioate.
| Compound Name | dimethyl 3-[(2R,3R,4S,5S,6R)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl]oxypentanedioate |
|---|---|
| PubChem CID | 10522707 |
| Molecular Formula | C13H21N3O9 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | dimethyl 3-[(2R,3R,4S,5S,6R)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl]oxypentanedioate |
| SMILES | COC(=O)CC(CC(=O)OC)O[C@@H]1O[C@H](CN=[N+]=[N-])[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H21N3O9/c1-22-8(17)3-6(4-9(18)23-2)24-13-12(21)11(20)10(19)7(25-13)5-15-16-14/h6-7,10-13,19-21H,3-5H2,1-2H3/t7-,10-,11+,12-,13-/m1/s1 |
| InChIKey | BVCIYDXONOBQGR-WPTBKURFSA-N |
| XLogP | -1.38 |
| TPSA | 180.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|