C20H14FN3O3 — CID 175129325
2-[4-[(3-cyano-2-fluorophenyl)methoxy]phenyl]-4-methylpyrimidine-5-carboxylic acid (PubChem CID 175129325) has the molecular formula C20H14FN3O3 and a molecular weight of 363.35 g/mol. Its IUPAC name is 2-[4-[(3-cyano-2-fluorophenyl)methoxy]phenyl]-4-methylpyrimidine-5-carboxylic acid.
| Compound Name | 2-[4-[(3-cyano-2-fluorophenyl)methoxy]phenyl]-4-methylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 175129325 |
| Molecular Formula | C20H14FN3O3 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-[4-[(3-cyano-2-fluorophenyl)methoxy]phenyl]-4-methylpyrimidine-5-carboxylic acid |
| SMILES | Cc1nc(-c2ccc(OCc3cccc(C#N)c3F)cc2)ncc1C(=O)O |
| InChI | InChI=1S/C20H14FN3O3/c1-12-17(20(25)26)10-23-19(24-12)13-5-7-16(8-6-13)27-11-15-4-2-3-14(9-22)18(15)21/h2-8,10H,11H2,1H3,(H,25,26) |
| InChIKey | QVNVYWLNZZKEAD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |