C13H10FN3O2 — CID 107118637
1-[(3-cyano-2-fluorophenyl)methyl]-3-methylpyrazole-4-carboxylic acid (PubChem CID 107118637) has the molecular formula C13H10FN3O2 and a molecular weight of 259.24 g/mol. Its IUPAC name is 1-[(3-cyano-2-fluorophenyl)methyl]-3-methylpyrazole-4-carboxylic acid.
| Compound Name | 1-[(3-cyano-2-fluorophenyl)methyl]-3-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107118637 |
| Molecular Formula | C13H10FN3O2 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-[(3-cyano-2-fluorophenyl)methyl]-3-methylpyrazole-4-carboxylic acid |
| SMILES | Cc1nn(Cc2cccc(C#N)c2F)cc1C(=O)O |
| InChI | InChI=1S/C13H10FN3O2/c1-8-11(13(18)19)7-17(16-8)6-10-4-2-3-9(5-15)12(10)14/h2-4,7H,6H2,1H3,(H,18,19) |
| InChIKey | RVZAWGYJVHVNLI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |