4-ethyl-2,2-dimethylhexane;peroxyformic acid

C11H24O3 — CID 175131115

IUPAC4-ethyl-2,2-dimethylhexane;peroxyformic acid
SMILESCCC(CC)CC(C)(C)C.O=COO
InChIInChI=1S/C10H22.CH2O3/c1-6-9(7-2)8-10(3,4)5;2-1-4-3/h9H,6-8H2,1-5H3;1,3H
InChIKeyQPOYCKREBCRXAI-UHFFFAOYSA-N
MW204.31 g/mol
LogP3.49
Rot. Bonds4

About 4-ethyl-2,2-dimethylhexane;peroxyformic acid

4-ethyl-2,2-dimethylhexane;peroxyformic acid (PubChem CID 175131115) has the molecular formula C11H24O3 and a molecular weight of 204.31 g/mol. Its IUPAC name is 4-ethyl-2,2-dimethylhexane;peroxyformic acid.

Molecular Properties

Compound Name4-ethyl-2,2-dimethylhexane;peroxyformic acid
PubChem CID175131115
Molecular FormulaC11H24O3
Molecular Weight204.31 g/mol
Exact Mass204.17
IUPAC Name4-ethyl-2,2-dimethylhexane;peroxyformic acid
SMILESCCC(CC)CC(C)(C)C.O=COO
InChIInChI=1S/C10H22.CH2O3/c1-6-9(7-2)8-10(3,4)5;2-1-4-3/h9H,6-8H2,1-5H3;1,3H
InChIKeyQPOYCKREBCRXAI-UHFFFAOYSA-N
XLogP3.49
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.31
LogP ≤ 53.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze 4-ethyl-2,2-dimethylhexane;peroxyformic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethyl-2,2-dimethylhexane;peroxyformic acid?
The IUPAC name of 4-ethyl-2,2-dimethylhexane;peroxyformic acid (CID 175131115) is 4-ethyl-2,2-dimethylhexane;peroxyformic acid.
What is the SMILES notation for 4-ethyl-2,2-dimethylhexane;peroxyformic acid?
The canonical SMILES for 4-ethyl-2,2-dimethylhexane;peroxyformic acid is CCC(CC)CC(C)(C)C.O=COO.
What is the InChIKey of 4-ethyl-2,2-dimethylhexane;peroxyformic acid?
The InChIKey is QPOYCKREBCRXAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22.CH2O3/c1-6-9(7-2)8-10(3,4)5;2-1-4-3/h9H,6-8H2,1-5H3;1,3H.
What are the key properties of 4-ethyl-2,2-dimethylhexane;peroxyformic acid?
4-ethyl-2,2-dimethylhexane;peroxyformic acid has a molecular weight of 204.31 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,2-dimethylhexane;peroxyformic acid is sourced from PubChem (CID 175131115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).