C31H28ClN5O4S — CID 175131538
5,7,11-triamino-7-(2-chloro-4-phenoxyphenyl)-6-oxo-N-(1-prop-2-enoylpyrrolidin-3-yl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175131538) has the molecular formula C31H28ClN5O4S and a molecular weight of 602.12 g/mol. Its IUPAC name is 5,7,11-triamino-7-(2-chloro-4-phenoxyphenyl)-6-oxo-N-(1-prop-2-enoylpyrrolidin-3-yl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-7-(2-chloro-4-phenoxyphenyl)-6-oxo-N-(1-prop-2-enoylpyrrolidin-3-yl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175131538 |
| Molecular Formula | C31H28ClN5O4S |
| Molecular Weight | 602.12 g/mol |
| Exact Mass | 601.16 |
| IUPAC Name | 5,7,11-triamino-7-(2-chloro-4-phenoxyphenyl)-6-oxo-N-(1-prop-2-enoylpyrrolidin-3-yl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N1CCC(NC(=O)c2sc3c(N)ccc4c3c2C(N)C(=O)C4(N)c2ccc(Oc3ccccc3)cc2Cl)C1 |
| InChI | InChI=1S/C31H28ClN5O4S/c1-2-23(38)37-13-12-16(15-37)36-30(40)28-25-24-20(10-11-22(33)27(24)42-28)31(35,29(39)26(25)34)19-9-8-18(14-21(19)32)41-17-6-4-3-5-7-17/h2-11,14,16,26H,1,12-13,15,33-35H2,(H,36,40) |
| InChIKey | ORHLKCYCBWOOIE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.12 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|