C32H31N5O4S — CID 175138047
N-[(3R)-1-[(5R,7R)-5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]pyrrolidin-3-yl]prop-2-enamide (PubChem CID 175138047) has the molecular formula C32H31N5O4S and a molecular weight of 581.70 g/mol. Its IUPAC name is N-[(3R)-1-[(5R,7R)-5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3R)-1-[(5R,7R)-5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 175138047 |
| Molecular Formula | C32H31N5O4S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | N-[(3R)-1-[(5R,7R)-5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CCN(C(=O)c2sc3c(N)ccc4c3c2[C@@H](N)C(=O)[C@@]4(N)c2ccc(Oc3ccccc3)cc2C)C1 |
| InChI | InChI=1S/C32H31N5O4S/c1-3-24(38)36-18-13-14-37(16-18)31(40)29-26-25-22(11-12-23(33)28(25)42-29)32(35,30(39)27(26)34)21-10-9-20(15-17(21)2)41-19-7-5-4-6-8-19/h3-12,15,18,27H,1,13-14,16,33-35H2,2H3,(H,36,38)/t18-,27-,32-/m1/s1 |
| InChIKey | VUVXPLBHHKJMFH-WGJCSYENSA-N |
| XLogP | 3.89 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|