C32H34N4O4S — CID 175141834
5,7,11-triamino-N-(4-methoxycyclohexyl)-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175141834) has the molecular formula C32H34N4O4S and a molecular weight of 570.72 g/mol. Its IUPAC name is 5,7,11-triamino-N-(4-methoxycyclohexyl)-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-N-(4-methoxycyclohexyl)-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175141834 |
| Molecular Formula | C32H34N4O4S |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 5,7,11-triamino-N-(4-methoxycyclohexyl)-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | COC1CCC(NC(=O)c2sc3c(N)ccc4c3c2C(N)C(=O)C4(N)c2ccc(Oc3ccccc3)cc2C)CC1 |
| InChI | InChI=1S/C32H34N4O4S/c1-17-16-21(40-20-6-4-3-5-7-20)12-13-22(17)32(35)23-14-15-24(33)28-25(23)26(27(34)30(32)37)29(41-28)31(38)36-18-8-10-19(39-2)11-9-18/h3-7,12-16,18-19,27H,8-11,33-35H2,1-2H3,(H,36,38) |
| InChIKey | YDHPFBDFDUVWTG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 142.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|