C30H30N4O4S — CID 175135881
5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-N-(oxan-3-yl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175135881) has the molecular formula C30H30N4O4S and a molecular weight of 542.66 g/mol. Its IUPAC name is 5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-N-(oxan-3-yl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-N-(oxan-3-yl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175135881 |
| Molecular Formula | C30H30N4O4S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-N-(oxan-3-yl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1cc(Oc2ccccc2)ccc1C1(N)C(=O)C(N)c2c(C(=O)NC3CCCOC3)sc3c(N)ccc1c23 |
| InChI | InChI=1S/C30H30N4O4S/c1-16-14-19(38-18-7-3-2-4-8-18)9-10-20(16)30(33)21-11-12-22(31)26-23(21)24(25(32)28(30)35)27(39-26)29(36)34-17-6-5-13-37-15-17/h2-4,7-12,14,17,25H,5-6,13,15,31-33H2,1H3,(H,34,36) |
| InChIKey | VRBPYBNNQLTXKV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 142.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|