C31H32N4O4S — CID 175140330
5,7,11-triamino-N-(2-hydroxycyclohexyl)-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175140330) has the molecular formula C31H32N4O4S and a molecular weight of 556.69 g/mol. Its IUPAC name is 5,7,11-triamino-N-(2-hydroxycyclohexyl)-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-N-(2-hydroxycyclohexyl)-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175140330 |
| Molecular Formula | C31H32N4O4S |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 5,7,11-triamino-N-(2-hydroxycyclohexyl)-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1cc(Oc2ccccc2)ccc1C1(N)C(=O)C(N)c2c(C(=O)NC3CCCCC3O)sc3c(N)ccc1c23 |
| InChI | InChI=1S/C31H32N4O4S/c1-16-15-18(39-17-7-3-2-4-8-17)11-12-19(16)31(34)20-13-14-21(32)27-24(20)25(26(33)29(31)37)28(40-27)30(38)35-22-9-5-6-10-23(22)36/h2-4,7-8,11-15,22-23,26,36H,5-6,9-10,32-34H2,1H3,(H,35,38) |
| InChIKey | CCQYBQOSVAMFJF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 153.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|