C33H35N5O4S — CID 175141839
5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(1S,3R)-3-(propanoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175141839) has the molecular formula C33H35N5O4S and a molecular weight of 597.74 g/mol. Its IUPAC name is 5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(1S,3R)-3-(propanoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(1S,3R)-3-(propanoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175141839 |
| Molecular Formula | C33H35N5O4S |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | 5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(1S,3R)-3-(propanoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | CCC(=O)N[C@@H]1CC[C@H](NC(=O)c2sc3c(N)ccc4c3c2C(N)C(=O)C4(N)c2ccc(Oc3ccccc3)cc2C)C1 |
| InChI | InChI=1S/C33H35N5O4S/c1-3-25(39)37-18-9-10-19(16-18)38-32(41)30-27-26-23(13-14-24(34)29(26)43-30)33(36,31(40)28(27)35)22-12-11-21(15-17(22)2)42-20-7-5-4-6-8-20/h4-8,11-15,18-19,28H,3,9-10,16,34-36H2,1-2H3,(H,37,39)(H,38,41)/t18-,19+,28?,33?/m1/s1 |
| InChIKey | QQYPYNQNOKQREA-LUVBAYEFSA-N |
| XLogP | 4.55 |
| TPSA | 162.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|