C32H34N6O4S — CID 175140821
5,7,11-triamino-N-[(1R,3R)-3-[(2-aminoacetyl)amino]cyclopentyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175140821) has the molecular formula C32H34N6O4S and a molecular weight of 598.73 g/mol. Its IUPAC name is 5,7,11-triamino-N-[(1R,3R)-3-[(2-aminoacetyl)amino]cyclopentyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-N-[(1R,3R)-3-[(2-aminoacetyl)amino]cyclopentyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175140821 |
| Molecular Formula | C32H34N6O4S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | 5,7,11-triamino-N-[(1R,3R)-3-[(2-aminoacetyl)amino]cyclopentyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1cc(Oc2ccccc2)ccc1C1(N)C(=O)C(N)c2c(C(=O)N[C@@H]3CC[C@@H](NC(=O)CN)C3)sc3c(N)ccc1c23 |
| InChI | InChI=1S/C32H34N6O4S/c1-16-13-20(42-19-5-3-2-4-6-19)9-10-21(16)32(36)22-11-12-23(34)28-25(22)26(27(35)30(32)40)29(43-28)31(41)38-18-8-7-17(14-18)37-24(39)15-33/h2-6,9-13,17-18,27H,7-8,14-15,33-36H2,1H3,(H,37,39)(H,38,41)/t17-,18-,27?,32?/m1/s1 |
| InChIKey | MOERJURWLARVAF-WCJNRCGFSA-N |
| XLogP | 3.09 |
| TPSA | 188.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|