C31H33N5O3S — CID 175134962
5,7,11-triamino-N-[(1R,2R)-2-aminocyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175134962) has the molecular formula C31H33N5O3S and a molecular weight of 555.70 g/mol. Its IUPAC name is 5,7,11-triamino-N-[(1R,2R)-2-aminocyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-N-[(1R,2R)-2-aminocyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175134962 |
| Molecular Formula | C31H33N5O3S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 5,7,11-triamino-N-[(1R,2R)-2-aminocyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1cc(Oc2ccccc2)ccc1C1(N)C(=O)C(N)c2c(C(=O)N[C@@H]3CCCC[C@H]3N)sc3c(N)ccc1c23 |
| InChI | InChI=1S/C31H33N5O3S/c1-16-15-18(39-17-7-3-2-4-8-17)11-12-19(16)31(35)20-13-14-22(33)27-24(20)25(26(34)29(31)37)28(40-27)30(38)36-23-10-6-5-9-21(23)32/h2-4,7-8,11-15,21,23,26H,5-6,9-10,32-35H2,1H3,(H,36,38)/t21-,23-,26?,31?/m1/s1 |
| InChIKey | SCABURPULZOYTE-WUEYNFMXSA-N |
| XLogP | 4.37 |
| TPSA | 159.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|