C31H33N5O4S — CID 175137443
5,7,11-triamino-7-[4-(2-methoxyphenoxy)-2-methylphenyl]-6-oxo-N-piperidin-4-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175137443) has the molecular formula C31H33N5O4S and a molecular weight of 571.70 g/mol. Its IUPAC name is 5,7,11-triamino-7-[4-(2-methoxyphenoxy)-2-methylphenyl]-6-oxo-N-piperidin-4-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-7-[4-(2-methoxyphenoxy)-2-methylphenyl]-6-oxo-N-piperidin-4-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175137443 |
| Molecular Formula | C31H33N5O4S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | 5,7,11-triamino-7-[4-(2-methoxyphenoxy)-2-methylphenyl]-6-oxo-N-piperidin-4-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | COc1ccccc1Oc1ccc(C2(N)C(=O)C(N)c3c(C(=O)NC4CCNCC4)sc4c(N)ccc2c34)c(C)c1 |
| InChI | InChI=1S/C31H33N5O4S/c1-16-15-18(40-23-6-4-3-5-22(23)39-2)7-8-19(16)31(34)20-9-10-21(32)27-24(20)25(26(33)29(31)37)28(41-27)30(38)36-17-11-13-35-14-12-17/h3-10,15,17,26,35H,11-14,32-34H2,1-2H3,(H,36,38) |
| InChIKey | OEZOBHYOXHAASH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|