C27H25N3O5S — CID 175138213
methyl 5,7,11-triamino-7-[4-(2-methoxyphenoxy)-2-methylphenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylate (PubChem CID 175138213) has the molecular formula C27H25N3O5S and a molecular weight of 503.58 g/mol. Its IUPAC name is methyl 5,7,11-triamino-7-[4-(2-methoxyphenoxy)-2-methylphenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylate.
| Compound Name | methyl 5,7,11-triamino-7-[4-(2-methoxyphenoxy)-2-methylphenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 175138213 |
| Molecular Formula | C27H25N3O5S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | methyl 5,7,11-triamino-7-[4-(2-methoxyphenoxy)-2-methylphenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylate |
| SMILES | COC(=O)c1sc2c(N)ccc3c2c1C(N)C(=O)C3(N)c1ccc(Oc2ccccc2OC)cc1C |
| InChI | InChI=1S/C27H25N3O5S/c1-13-12-14(35-19-7-5-4-6-18(19)33-2)8-9-15(13)27(30)16-10-11-17(28)23-20(16)21(22(29)25(27)31)24(36-23)26(32)34-3/h4-12,22H,28-30H2,1-3H3 |
| InChIKey | OSMKJSLHKUVIAT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 139.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|