C25H29N5O3S — CID 175139380
5,7,11-triamino-7-(4-methoxy-2-methylphenyl)-6-oxo-N-piperidin-3-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175139380) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is 5,7,11-triamino-7-(4-methoxy-2-methylphenyl)-6-oxo-N-piperidin-3-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-7-(4-methoxy-2-methylphenyl)-6-oxo-N-piperidin-3-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175139380 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 5,7,11-triamino-7-(4-methoxy-2-methylphenyl)-6-oxo-N-piperidin-3-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | COc1ccc(C2(N)C(=O)C(N)c3c(C(=O)NC4CCCNC4)sc4c(N)ccc2c34)c(C)c1 |
| InChI | InChI=1S/C25H29N5O3S/c1-12-10-14(33-2)5-6-15(12)25(28)16-7-8-17(26)21-18(16)19(20(27)23(25)31)22(34-21)24(32)30-13-4-3-9-29-11-13/h5-8,10,13,20,29H,3-4,9,11,26-28H2,1-2H3,(H,30,32) |
| InChIKey | QLJYYOJTRDSQPM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|