C30H37N5O3S — CID 175137523
5,7,11-triamino-7-(4-cyclopentyloxy-2-methylphenyl)-N-(1-methylpiperidin-3-yl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175137523) has the molecular formula C30H37N5O3S and a molecular weight of 547.73 g/mol. Its IUPAC name is 5,7,11-triamino-7-(4-cyclopentyloxy-2-methylphenyl)-N-(1-methylpiperidin-3-yl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-7-(4-cyclopentyloxy-2-methylphenyl)-N-(1-methylpiperidin-3-yl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175137523 |
| Molecular Formula | C30H37N5O3S |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | 5,7,11-triamino-7-(4-cyclopentyloxy-2-methylphenyl)-N-(1-methylpiperidin-3-yl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1cc(OC2CCCC2)ccc1C1(N)C(=O)C(N)c2c(C(=O)NC3CCCN(C)C3)sc3c(N)ccc1c23 |
| InChI | InChI=1S/C30H37N5O3S/c1-16-14-19(38-18-7-3-4-8-18)9-10-20(16)30(33)21-11-12-22(31)26-23(21)24(25(32)28(30)36)27(39-26)29(37)34-17-6-5-13-35(2)15-17/h9-12,14,17-18,25H,3-8,13,15,31-33H2,1-2H3,(H,34,37) |
| InChIKey | HLTIVVTUJCJSTM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|