About fluoro(diphenoxy)borane;pyridine
fluoro(diphenoxy)borane;pyridine (PubChem CID 175132210) has the molecular formula C17H15BFNO2
and a molecular weight of 295.12 g/mol. Its IUPAC name is fluoro(diphenoxy)borane;pyridine.
Molecular Properties
| Compound Name | fluoro(diphenoxy)borane;pyridine |
| PubChem CID | 175132210 |
| Molecular Formula | C17H15BFNO2 |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | fluoro(diphenoxy)borane;pyridine |
| SMILES | FB(Oc1ccccc1)Oc1ccccc1.c1ccncc1 |
| InChI | InChI=1S/C12H10BFO2.C5H5N/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;1-2-4-6-5-3-1/h1-10H;1-5H |
| InChIKey | MFGSMJBDONOTNC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluoro(diphenoxy)borane;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro(diphenoxy)borane;pyridine?
The IUPAC name of fluoro(diphenoxy)borane;pyridine (CID 175132210) is fluoro(diphenoxy)borane;pyridine.
What is the SMILES notation for fluoro(diphenoxy)borane;pyridine?
The canonical SMILES for fluoro(diphenoxy)borane;pyridine is FB(Oc1ccccc1)Oc1ccccc1.c1ccncc1.
What is the InChIKey of fluoro(diphenoxy)borane;pyridine?
The InChIKey is MFGSMJBDONOTNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BFO2.C5H5N/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;1-2-4-6-5-3-1/h1-10H;1-5H.
What are the key properties of fluoro(diphenoxy)borane;pyridine?
fluoro(diphenoxy)borane;pyridine has a molecular weight of 295.12 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro(diphenoxy)borane;pyridine is sourced from PubChem (CID 175132210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).