About methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one
methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one (PubChem CID 175132925) has the molecular formula C18H28O6S
and a molecular weight of 372.48 g/mol. Its IUPAC name is methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one.
Molecular Properties
| Compound Name | methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one |
| PubChem CID | 175132925 |
| Molecular Formula | C18H28O6S |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one |
| SMILES | CCC(=O)CSc1ccoc1C.COC(=O)CCCC(C)OC(C)=O |
| InChI | InChI=1S/C9H16O4.C9H12O2S/c1-7(13-8(2)10)5-4-6-9(11)12-3;1-3-8(10)6-12-9-4-5-11-7(9)2/h7H,4-6H2,1-3H3;4-5H,3,6H2,1-2H3 |
| InChIKey | YLFKQXPYBZVMID-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one?
The IUPAC name of methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one (CID 175132925) is methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one.
What is the SMILES notation for methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one?
The canonical SMILES for methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one is CCC(=O)CSc1ccoc1C.COC(=O)CCCC(C)OC(C)=O.
What is the InChIKey of methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one?
The InChIKey is YLFKQXPYBZVMID-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.C9H12O2S/c1-7(13-8(2)10)5-4-6-9(11)12-3;1-3-8(10)6-12-9-4-5-11-7(9)2/h7H,4-6H2,1-3H3;4-5H,3,6H2,1-2H3.
What are the key properties of methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one?
methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one has a molecular weight of 372.48 g/mol, XLogP of 3.94, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-acetyloxyhexanoate;1-(2-methylfuran-3-yl)sulfanylbutan-2-one is sourced from PubChem (CID 175132925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).