About furan-2-ylmethyl propan-2-yl sulfate
furan-2-ylmethyl propan-2-yl sulfate (PubChem CID 175133306) has the molecular formula C8H12O5S
and a molecular weight of 220.25 g/mol. Its IUPAC name is furan-2-ylmethyl propan-2-yl sulfate.
Molecular Properties
| Compound Name | furan-2-ylmethyl propan-2-yl sulfate |
| PubChem CID | 175133306 |
| Molecular Formula | C8H12O5S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | furan-2-ylmethyl propan-2-yl sulfate |
| SMILES | CC(C)OS(=O)(=O)OCc1ccco1 |
| InChI | InChI=1S/C8H12O5S/c1-7(2)13-14(9,10)12-6-8-4-3-5-11-8/h3-5,7H,6H2,1-2H3 |
| InChIKey | RQRDBTXJRGJCQL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze furan-2-ylmethyl propan-2-yl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethyl propan-2-yl sulfate?
The IUPAC name of furan-2-ylmethyl propan-2-yl sulfate (CID 175133306) is furan-2-ylmethyl propan-2-yl sulfate.
What is the SMILES notation for furan-2-ylmethyl propan-2-yl sulfate?
The canonical SMILES for furan-2-ylmethyl propan-2-yl sulfate is CC(C)OS(=O)(=O)OCc1ccco1.
What is the InChIKey of furan-2-ylmethyl propan-2-yl sulfate?
The InChIKey is RQRDBTXJRGJCQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O5S/c1-7(2)13-14(9,10)12-6-8-4-3-5-11-8/h3-5,7H,6H2,1-2H3.
What are the key properties of furan-2-ylmethyl propan-2-yl sulfate?
furan-2-ylmethyl propan-2-yl sulfate has a molecular weight of 220.25 g/mol, XLogP of 1.47, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethyl propan-2-yl sulfate is sourced from PubChem (CID 175133306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).