About azane;carbonic acid;4-chloro-2-methylbenzonitrile
azane;carbonic acid;4-chloro-2-methylbenzonitrile (PubChem CID 175133680) has the molecular formula C10H13ClN2O6
and a molecular weight of 292.68 g/mol. Its IUPAC name is azane;carbonic acid;4-chloro-2-methylbenzonitrile.
Molecular Properties
| Compound Name | azane;carbonic acid;4-chloro-2-methylbenzonitrile |
| PubChem CID | 175133680 |
| Molecular Formula | C10H13ClN2O6 |
| Molecular Weight | 292.68 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | azane;carbonic acid;4-chloro-2-methylbenzonitrile |
| SMILES | Cc1cc(Cl)ccc1C#N.N.O=C(O)O.O=C(O)O |
| InChI | InChI=1S/C8H6ClN.2CH2O3.H3N/c1-6-4-8(9)3-2-7(6)5-10;2*2-1(3)4;/h2-4H,1H3;2*(H2,2,3,4);1H3 |
| InChIKey | HPLBHDZVXHXYSD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 173.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.68 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;carbonic acid;4-chloro-2-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;carbonic acid;4-chloro-2-methylbenzonitrile?
The IUPAC name of azane;carbonic acid;4-chloro-2-methylbenzonitrile (CID 175133680) is azane;carbonic acid;4-chloro-2-methylbenzonitrile.
What is the SMILES notation for azane;carbonic acid;4-chloro-2-methylbenzonitrile?
The canonical SMILES for azane;carbonic acid;4-chloro-2-methylbenzonitrile is Cc1cc(Cl)ccc1C#N.N.O=C(O)O.O=C(O)O.
What is the InChIKey of azane;carbonic acid;4-chloro-2-methylbenzonitrile?
The InChIKey is HPLBHDZVXHXYSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN.2CH2O3.H3N/c1-6-4-8(9)3-2-7(6)5-10;2*2-1(3)4;/h2-4H,1H3;2*(H2,2,3,4);1H3.
What are the key properties of azane;carbonic acid;4-chloro-2-methylbenzonitrile?
azane;carbonic acid;4-chloro-2-methylbenzonitrile has a molecular weight of 292.68 g/mol, XLogP of 3.13, 0 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;carbonic acid;4-chloro-2-methylbenzonitrile is sourced from PubChem (CID 175133680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).