acetic acid;3,5-dihydroxy-3-methylpentanoic acid

C8H16O6 — CID 175134746

IUPACacetic acid;3,5-dihydroxy-3-methylpentanoic acid
SMILESCC(=O)O.CC(O)(CCO)CC(=O)O
InChIInChI=1S/C6H12O4.C2H4O2/c1-6(10,2-3-7)4-5(8)9;1-2(3)4/h7,10H,2-4H2,1H3,(H,8,9);1H3,(H,3,4)
InChIKeyCQRCVBFZOCBKJH-UHFFFAOYSA-N
MW208.21 g/mol
LogP-0.31
Rot. Bonds4

About acetic acid;3,5-dihydroxy-3-methylpentanoic acid

acetic acid;3,5-dihydroxy-3-methylpentanoic acid (PubChem CID 175134746) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is acetic acid;3,5-dihydroxy-3-methylpentanoic acid.

Molecular Properties

Compound Nameacetic acid;3,5-dihydroxy-3-methylpentanoic acid
PubChem CID175134746
Molecular FormulaC8H16O6
Molecular Weight208.21 g/mol
Exact Mass208.09
IUPAC Nameacetic acid;3,5-dihydroxy-3-methylpentanoic acid
SMILESCC(=O)O.CC(O)(CCO)CC(=O)O
InChIInChI=1S/C6H12O4.C2H4O2/c1-6(10,2-3-7)4-5(8)9;1-2(3)4/h7,10H,2-4H2,1H3,(H,8,9);1H3,(H,3,4)
InChIKeyCQRCVBFZOCBKJH-UHFFFAOYSA-N
XLogP-0.31
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.21
LogP ≤ 5-0.31
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze acetic acid;3,5-dihydroxy-3-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;3,5-dihydroxy-3-methylpentanoic acid?
The IUPAC name of acetic acid;3,5-dihydroxy-3-methylpentanoic acid (CID 175134746) is acetic acid;3,5-dihydroxy-3-methylpentanoic acid.
What is the SMILES notation for acetic acid;3,5-dihydroxy-3-methylpentanoic acid?
The canonical SMILES for acetic acid;3,5-dihydroxy-3-methylpentanoic acid is CC(=O)O.CC(O)(CCO)CC(=O)O.
What is the InChIKey of acetic acid;3,5-dihydroxy-3-methylpentanoic acid?
The InChIKey is CQRCVBFZOCBKJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O4.C2H4O2/c1-6(10,2-3-7)4-5(8)9;1-2(3)4/h7,10H,2-4H2,1H3,(H,8,9);1H3,(H,3,4).
What are the key properties of acetic acid;3,5-dihydroxy-3-methylpentanoic acid?
acetic acid;3,5-dihydroxy-3-methylpentanoic acid has a molecular weight of 208.21 g/mol, XLogP of -0.31, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3,5-dihydroxy-3-methylpentanoic acid is sourced from PubChem (CID 175134746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).