C10H23NO4 — CID 175459408
3,5-dihydroxy-3-methylpentanoate;tetramethylazanium (PubChem CID 175459408) has the molecular formula C10H23NO4 and a molecular weight of 221.30 g/mol. Its IUPAC name is 3,5-dihydroxy-3-methylpentanoate;tetramethylazanium.
| Compound Name | 3,5-dihydroxy-3-methylpentanoate;tetramethylazanium |
|---|---|
| PubChem CID | 175459408 |
| Molecular Formula | C10H23NO4 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 3,5-dihydroxy-3-methylpentanoate;tetramethylazanium |
| SMILES | CC(O)(CCO)CC(=O)[O-].C[N+](C)(C)C |
| InChI | InChI=1S/C6H12O4.C4H12N/c1-6(10,2-3-7)4-5(8)9;1-5(2,3)4/h7,10H,2-4H2,1H3,(H,8,9);1-4H3/q;+1/p-1 |
| InChIKey | GFRLOLBOCYXUAG-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|