About 2-(selenan-2-yl)butanoic acid
2-(selenan-2-yl)butanoic acid (PubChem CID 175135196) has the molecular formula C9H16O2Se
and a molecular weight of 235.18 g/mol. Its IUPAC name is 2-(selenan-2-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-(selenan-2-yl)butanoic acid |
| PubChem CID | 175135196 |
| Molecular Formula | C9H16O2Se |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2-(selenan-2-yl)butanoic acid |
| SMILES | CCC(C(=O)O)C1CCCC[Se]1 |
| InChI | InChI=1S/C9H16O2Se/c1-2-7(9(10)11)8-5-3-4-6-12-8/h7-8H,2-6H2,1H3,(H,10,11) |
| InChIKey | FXYYXXKGKVXVOI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(selenan-2-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(selenan-2-yl)butanoic acid?
The IUPAC name of 2-(selenan-2-yl)butanoic acid (CID 175135196) is 2-(selenan-2-yl)butanoic acid.
What is the SMILES notation for 2-(selenan-2-yl)butanoic acid?
The canonical SMILES for 2-(selenan-2-yl)butanoic acid is CCC(C(=O)O)C1CCCC[Se]1.
What is the InChIKey of 2-(selenan-2-yl)butanoic acid?
The InChIKey is FXYYXXKGKVXVOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2Se/c1-2-7(9(10)11)8-5-3-4-6-12-8/h7-8H,2-6H2,1H3,(H,10,11).
What are the key properties of 2-(selenan-2-yl)butanoic acid?
2-(selenan-2-yl)butanoic acid has a molecular weight of 235.18 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(selenan-2-yl)butanoic acid is sourced from PubChem (CID 175135196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).