C16H24N2O4 — CID 175135260
6-ethoxy-4-propan-2-yloxy-1H-indole-2-carboxylic acid;N-methylmethanamine (PubChem CID 175135260) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 6-ethoxy-4-propan-2-yloxy-1H-indole-2-carboxylic acid;N-methylmethanamine.
| Compound Name | 6-ethoxy-4-propan-2-yloxy-1H-indole-2-carboxylic acid;N-methylmethanamine |
|---|---|
| PubChem CID | 175135260 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 6-ethoxy-4-propan-2-yloxy-1H-indole-2-carboxylic acid;N-methylmethanamine |
| SMILES | CCOc1cc(OC(C)C)c2cc(C(=O)O)[nH]c2c1.CNC |
| InChI | InChI=1S/C14H17NO4.C2H7N/c1-4-18-9-5-11-10(7-12(15-11)14(16)17)13(6-9)19-8(2)3;1-3-2/h5-8,15H,4H2,1-3H3,(H,16,17);3H,1-2H3 |
| InChIKey | MDAVGVGMXJMLRI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |