C22H32N2O4 — CID 156634349
2-piperidin-1-ylethyl 4,6-di(propan-2-yloxy)-1H-indole-2-carboxylate (PubChem CID 156634349) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 4,6-di(propan-2-yloxy)-1H-indole-2-carboxylate.
| Compound Name | 2-piperidin-1-ylethyl 4,6-di(propan-2-yloxy)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 156634349 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-piperidin-1-ylethyl 4,6-di(propan-2-yloxy)-1H-indole-2-carboxylate |
| SMILES | CC(C)Oc1cc(OC(C)C)c2cc(C(=O)OCCN3CCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C22H32N2O4/c1-15(2)27-17-12-19-18(21(13-17)28-16(3)4)14-20(23-19)22(25)26-11-10-24-8-6-5-7-9-24/h12-16,23H,5-11H2,1-4H3 |
| InChIKey | RSUCHFDXJPSAFF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |