C24H34N2O5 — CID 156634424
2-morpholin-4-ylethyl 4-cyclohexyloxy-6-propan-2-yloxy-1H-indole-2-carboxylate (PubChem CID 156634424) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 4-cyclohexyloxy-6-propan-2-yloxy-1H-indole-2-carboxylate.
| Compound Name | 2-morpholin-4-ylethyl 4-cyclohexyloxy-6-propan-2-yloxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 156634424 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 2-morpholin-4-ylethyl 4-cyclohexyloxy-6-propan-2-yloxy-1H-indole-2-carboxylate |
| SMILES | CC(C)Oc1cc(OC2CCCCC2)c2cc(C(=O)OCCN3CCOCC3)[nH]c2c1 |
| InChI | InChI=1S/C24H34N2O5/c1-17(2)30-19-14-21-20(23(15-19)31-18-6-4-3-5-7-18)16-22(25-21)24(27)29-13-10-26-8-11-28-12-9-26/h14-18,25H,3-13H2,1-2H3 |
| InChIKey | KAOOTKCCVHYOHQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |