C18H27N3O4 — CID 175136889
N-methylmethanamine;4-morpholin-4-yl-6-propan-2-yloxy-1H-indole-2-carboxylic acid (PubChem CID 175136889) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-methylmethanamine;4-morpholin-4-yl-6-propan-2-yloxy-1H-indole-2-carboxylic acid.
| Compound Name | N-methylmethanamine;4-morpholin-4-yl-6-propan-2-yloxy-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 175136889 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | N-methylmethanamine;4-morpholin-4-yl-6-propan-2-yloxy-1H-indole-2-carboxylic acid |
| SMILES | CC(C)Oc1cc(N2CCOCC2)c2cc(C(=O)O)[nH]c2c1.CNC |
| InChI | InChI=1S/C16H20N2O4.C2H7N/c1-10(2)22-11-7-13-12(9-14(17-13)16(19)20)15(8-11)18-3-5-21-6-4-18;1-3-2/h7-10,17H,3-6H2,1-2H3,(H,19,20);3H,1-2H3 |
| InChIKey | RJPAXVHZUYWMPH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |