C22H20N4O2S — CID 175136203
N-[3-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]propyl]furan-2-carboxamide (PubChem CID 175136203) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is N-[3-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]propyl]furan-2-carboxamide.
| Compound Name | N-[3-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 175136203 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[3-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]propyl]furan-2-carboxamide |
| SMILES | O=C(NCCCSc1ccc2c(C=Cc3ccccn3)n[nH]c2c1)c1ccco1 |
| InChI | InChI=1S/C22H20N4O2S/c27-22(21-6-3-13-28-21)24-12-4-14-29-17-8-9-18-19(25-26-20(18)15-17)10-7-16-5-1-2-11-23-16/h1-3,5-11,13,15H,4,12,14H2,(H,24,27)(H,25,26) |
| InChIKey | BNWRSEAESKQBNM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|