C28H28N4O3S — CID 162325055
methyl 7-oxo-7-[2-[[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]sulfanyl]anilino]heptanoate (PubChem CID 162325055) has the molecular formula C28H28N4O3S and a molecular weight of 500.62 g/mol. Its IUPAC name is methyl 7-oxo-7-[2-[[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]sulfanyl]anilino]heptanoate.
| Compound Name | methyl 7-oxo-7-[2-[[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]sulfanyl]anilino]heptanoate |
|---|---|
| PubChem CID | 162325055 |
| Molecular Formula | C28H28N4O3S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | methyl 7-oxo-7-[2-[[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]sulfanyl]anilino]heptanoate |
| SMILES | COC(=O)CCCCCC(=O)Nc1ccccc1Sc1ccc2c(/C=C/c3ccccn3)n[nH]c2c1 |
| InChI | InChI=1S/C28H28N4O3S/c1-35-28(34)13-4-2-3-12-27(33)30-24-10-5-6-11-26(24)36-21-15-16-22-23(31-32-25(22)19-21)17-14-20-9-7-8-18-29-20/h5-11,14-19H,2-4,12-13H2,1H3,(H,30,33)(H,31,32)/b17-14+ |
| InChIKey | OVPYKGNXHNBHIO-SAPNQHFASA-N |
| XLogP | 6.34 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|