C28H28N4O3S — CID 68894241
8-oxo-8-[2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]anilino]octanoic acid (PubChem CID 68894241) has the molecular formula C28H28N4O3S and a molecular weight of 500.62 g/mol. Its IUPAC name is 8-oxo-8-[2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]anilino]octanoic acid.
| Compound Name | 8-oxo-8-[2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]anilino]octanoic acid |
|---|---|
| PubChem CID | 68894241 |
| Molecular Formula | C28H28N4O3S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 8-oxo-8-[2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]anilino]octanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)Nc1ccccc1Sc1ccc2c(C=Cc3ccccn3)n[nH]c2c1 |
| InChI | InChI=1S/C28H28N4O3S/c33-27(12-3-1-2-4-13-28(34)35)30-24-10-5-6-11-26(24)36-21-15-16-22-23(31-32-25(22)19-21)17-14-20-9-7-8-18-29-20/h5-11,14-19H,1-4,12-13H2,(H,30,33)(H,31,32)(H,34,35) |
| InChIKey | ICMUQCNKCXJQFV-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|