C27H29N5O2S — CID 91270234
N-hydroxy-7-[2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]anilino]heptanamide (PubChem CID 91270234) has the molecular formula C27H29N5O2S and a molecular weight of 487.63 g/mol. Its IUPAC name is N-hydroxy-7-[2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]anilino]heptanamide.
| Compound Name | N-hydroxy-7-[2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]anilino]heptanamide |
|---|---|
| PubChem CID | 91270234 |
| Molecular Formula | C27H29N5O2S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N-hydroxy-7-[2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]anilino]heptanamide |
| SMILES | O=C(CCCCCCNc1ccccc1Sc1ccc2c(C=Cc3ccccn3)n[nH]c2c1)NO |
| InChI | InChI=1S/C27H29N5O2S/c33-27(32-34)12-3-1-2-7-18-29-24-10-4-5-11-26(24)35-21-14-15-22-23(30-31-25(22)19-21)16-13-20-9-6-8-17-28-20/h4-6,8-11,13-17,19,29,34H,1-3,7,12,18H2,(H,30,31)(H,32,33) |
| InChIKey | CVZVTOMRSHJUMG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|